| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Boc-O-tert-butyl-L-serine dicyclohexylamine salt Basic information |
| | Boc-O-tert-butyl-L-serine dicyclohexylamine salt Chemical Properties |
| Melting point | 161-164 °C | | alpha | 24.5 º (C=1% IN DMF) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Solid | | Appearance | White to off-white Solid | | Optical Rotation | [α]20/D +24.5±1.5°, c = 1% in DMF | | BRN | 5207271 | | InChI | 1S/C12H23NO5.C12H23N/c1-11(2,3)17-7-8(9(14)15)13-10(16)18-12(4,5)6;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h8H,7H2,1-6H3,(H,13,16)(H,14,15);11-13H,1-10H2/t8-;/m0./s1 | | InChIKey | AIEUUHIXSUNTGV-QRPNPIFTSA-N | | SMILES | C1CCC(CC1)NC2CCCCC2.CC(C)(C)OC[C@H](NC(=O)OC(C)(C)C)C(O)=O | | CAS DataBase Reference | 18942-50-2(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2924 19 00 | | Storage Class | 11 - Combustible Solids |
| | Boc-O-tert-butyl-L-serine dicyclohexylamine salt Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-O-tert-butyl-L-serine dicyclohexylamine salt Preparation Products And Raw materials |
|