| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-Cyclohexen-1-yl trifluoromethane- Basic information |
| Product Name: | 1-Cyclohexen-1-yl trifluoromethane- | | Synonyms: | Cyclohex-1-en-1-yl triflate, 1-{[(Trifluoromethyl)sulphonyl]oxy}cyclohex-1-ene;Cyclohex-1-en-1-yl trifluoromethanesulphonate;1-Cyclohexenyl trifluoroMethanesulfonate 97%;cyclohexenyl triflate;Methanesulfonic acid, 1,1,1-trifluoro-, 1-cyclohexen-1-yl ester;CYCLOHEX-1-EN-1-YL TRIFLUOROMETHANESULPHONATE - NEW PRODUCT;cyclohexen-1-yl trifluoromethanesulfonate;cyclohex-1-en-1-yl trifluoromethanesulfonate | | CAS: | 28075-50-5 | | MF: | C7H9F3O3S | | MW: | 230.2 | | EINECS: | | | Product Categories: | Organic Building Blocks;Organic Triflates;Sulfur Compounds | | Mol File: | 28075-50-5.mol |  |
| | 1-Cyclohexen-1-yl trifluoromethane- Chemical Properties |
| Boiling point | 84-87 °C/4 mmHg (lit.) | | density | 1.315 g/mL at 25 °C (lit.) | | Fp | 160 °F | | storage temp. | 2-8°C | | form | Liquid | | color | Colorless to yellow | | InChI | 1S/C7H9F3O3S/c8-7(9,10)14(11,12)13-6-4-2-1-3-5-6/h4H,1-3,5H2 | | InChIKey | WVSCRRLWRRANJY-UHFFFAOYSA-N | | SMILES | FC(F)(F)S(=O)(=O)OC1=CCCCC1 |
| RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | HS Code | 2904990090 | | Storage Class | 10 - Combustible liquids |
| | 1-Cyclohexen-1-yl trifluoromethane- Usage And Synthesis |
| Uses | Cyclohex-1-en-1-yl Trifluoromethanesulfonate is used a reactant in the regioselective preparation of phenylpyrrolidines via C-H functionalization of amines with aryl halides. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 51, p. 277, 1986 DOI: 10.1021/jo00352a039 | | General Description | 1-Cyclohexenyl trifluoromethanesulfonate, also known as 1-cyclohexenyl triflate, is a cyclohexenyl sulfonate. Its trifluoromethylation reaction in the presence of different monodentate biaryl phosphine ligands has been investigated. The asymmetric Heck reaction of 1-cyclohexenyl trifluoromethanesulfonate using palladium complexes of phosphine oxazoline ligand has been studied. |
| | 1-Cyclohexen-1-yl trifluoromethane- Preparation Products And Raw materials |
|