| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Tin(II) trifluoromethanesulfonate Basic information |
| | Tin(II) trifluoromethanesulfonate Chemical Properties |
| Melting point | ≥300 °C (lit.) | | storage temp. | Inert atmosphere,2-8°C | | form | Powder | | color | White to yellow | | Water Solubility | Insoluble in water. | | Sensitive | Moisture Sensitive | | Stability: | hygroscopic | | InChI | 1S/2CHF3O3S.Sn/c2*2-1(3,4)8(5,6)7;/h2*(H,5,6,7);/q;;+2/p-2 | | InChIKey | RBGLVWCAGPITBS-UHFFFAOYSA-L | | SMILES | FC(F)(F)S(=O)(=O)O[SnH2]OS(=O)(=O)C(F)(F)F | | CAS DataBase Reference | 62086-04-8(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 34-36/37/38 | | Safety Statements | 26-36/37/39-45-37/39 | | RIDADR | UN 3146 6.1/PG 3 | | WGK Germany | 3 | | F | 1-10 | | Hazard Note | Corrosive | | TSCA | No | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29049090 | | Storage Class | 11 - Combustible Solids |
| | Tin(II) trifluoromethanesulfonate Usage And Synthesis |
| Description | Mild Lewis acid, primarily used to generate tin(II) enolates for stereoselective aldol and Michael reactions; [2,3]-Wittig and Ireland-Claisen rearrangements; addition of tin(II) acetylides to aldehydes; asymmetric allylation of aldehydes. | | Chemical Properties | White to yellowish powder | | Uses | Tin(II) trifluoromethanesulfonate is a mild Lewis acid used for stereoselective aldol and Michael reactions; [2,3]-Wittig and Ireland-Claisen rearrangements, Horner-Wadsworth-Emmons reactions, asymmetric [3 + 2] cycloaddition, ring opening reactions and Friedel-Crafts reactions. | | reaction suitability | core: tin reagent type: catalyst | | storage | Moisture and air sensitive; all handling and storage should be done under nitrogen. |
| | Tin(II) trifluoromethanesulfonate Preparation Products And Raw materials |
|