| Company Name: |
chemmole Gold |
| Tel: |
400-168-9330 15013243073 |
| Email: |
597760450@qq.com |
|
| | 4-CYANO-2-METHYLPYRIDINE Basic information |
| | 4-CYANO-2-METHYLPYRIDINE Chemical Properties |
| Melting point | NA | | Boiling point | 213℃ | | density | 1.08 | | Fp | 87℃ | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Chloroform, Methanol | | pka | 2.60±0.10(Predicted) | | form | solid | | color | Beige | | InChI | InChI=1S/C7H6N2/c1-6-4-7(5-8)2-3-9-6/h2-4H,1H3 | | InChIKey | SBWJLHPCEHEABR-UHFFFAOYSA-N | | SMILES | C1(C)=NC=CC(C#N)=C1 |
| | 4-CYANO-2-METHYLPYRIDINE Usage And Synthesis |
| Chemical Properties | Low-Melting Yellow Solid | | Uses | Intermediate in the preparation of calcium antagonists |
| | 4-CYANO-2-METHYLPYRIDINE Preparation Products And Raw materials |
|