| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 4-AMINO-3 6-DISULFO-1 8-NAPHTHALIC Basic information |
| Product Name: | 4-AMINO-3 6-DISULFO-1 8-NAPHTHALIC | | Synonyms: | 4-AMINO-3 6-DISULFO-1 8-NAPHTHALIC;4-amino-3,6-disulfo-1,8-naphthalic anhydride;4-amino-3,6-disulfo-1,8-naphthalic anhydride, dipotassium;4-AMino-3,6-disulfo-1,8-naphthalic anhydride dipotassiuM salt [Lucifer Yellow anhydride dipotassiuM salt];6-Amino-1,3-dioxo-1H,3H-benzo[de]isochromene-5,8-disulfonic acid dipotassium;4-Amino-3,6-disulfonaphthalic anhydride (dipotassium) | | CAS: | 79539-35-8 | | MF: | C12H8KNO9S2 | | MW: | 413.41 | | EINECS: | | | Product Categories: | | | Mol File: | 79539-35-8.mol |  |
| | 4-AMINO-3 6-DISULFO-1 8-NAPHTHALIC Chemical Properties |
| Melting point | >300 °C(lit.) | | storage temp. | room temp | | form | powder | | ε(extinction coefficient) | ≥20000 at 264-268nm in 0.1 M NaOH at 0.01g/L
≥30000 at 226-232nm in 0.1 M NaOH at 0.01g/L
≥8000 at 348-352nm in 0.1 M NaOH at 0.01g/L | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C12H7NO9S2.2K/c13-10-5-1-4(23(16,17)18)2-6-9(5)7(12(15)22-11(6)14)3-8(10)24(19,20)21;;/h1-3H,13H2,(H,16,17,18)(H,19,20,21);;/q;2*+1/p-2 | | InChIKey | MIOVHACHHDENNE-UHFFFAOYSA-L | | SMILES | [K+].[K+].Nc1c(cc2C(=O)OC(=O)c3cc(cc1c23)S([O-])(=O)=O)S([O-])(=O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-AMINO-3 6-DISULFO-1 8-NAPHTHALIC Usage And Synthesis |
| Description | 4-Amino-3,6-disulfo-1,8-naphthalic anhydride dipotassium salt is a building block for synthesis of water-soluble polar tracer such as lucifer yellow probes. | | Uses | 4-Amino-3,6-disulfo-1,8-naphthalic anhydride dipotassium salt is a useful dye for biological research purposes. It is a building block to water soluble polar tracer such as lucifer yellow probes and it can also be used as reagent/reactant in three-point recognition and selective fluorescence sensing of L-DOPA. Dyes and metabolites. |
| | 4-AMINO-3 6-DISULFO-1 8-NAPHTHALIC Preparation Products And Raw materials |
|