|
|
| | Calcium 2-ethylhexanoate Basic information |
| | Calcium 2-ethylhexanoate Chemical Properties |
| density | 1.07[at 20℃] | | vapor pressure | 0-4Pa at 20℃ | | form | liquid | | Water Solubility | Insoluble in water. | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | 1S/2C8H16O2.Ca/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2 | | InChIKey | LTPCXXMGKDQPAO-UHFFFAOYSA-L | | SMILES | CCCCC(CC)C(=O)O[Ca]OC(=O)C(CC)CCCC | | LogP | 2.7 at 25℃ | | CAS DataBase Reference | 136-51-6(CAS DataBase Reference) | | EPA Substance Registry System | Calcium 2-ethylhexanoate (136-51-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-24/25 | | WGK Germany | 1 | | TSCA | TSCA listed | | HS Code | 29159080 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Repr. 1B |
| | Calcium 2-ethylhexanoate Usage And Synthesis |
| Chemical Properties | white to almost white powder | | Uses | Calcium 2-Ethylhexanoate is a Calcium source that is soluble in organic solvents as an organometallic compound (also known as metalorganic, organo-inorganic and metallo-organic compounds).
Calcium 2-ethylhexanoate has little drying action itself but is very useful in combination with other metals. Calcium driers are also good as pigment wetting and dispersing agents. | | Uses | Calcium 2-ethylhexanoate is used as an organic chemical synthesis intermediate. | | Flammability and Explosibility | Not classified | | reaction suitability | core: calcium |
| | Calcium 2-ethylhexanoate Preparation Products And Raw materials |
|