| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Hydroxy-3-methoxybenzyl alcohol Basic information |
| | 2-Hydroxy-3-methoxybenzyl alcohol Chemical Properties |
| Melting point | 61-63 °C (lit.) | | Boiling point | 135 °C/0.2 mmHg (lit.) | | density | 1.1690 (rough estimate) | | refractive index | 1.4620 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 9.93±0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C8H10O3/c1-11-7-4-2-3-6(5-9)8(7)10/h2-4,9-10H,5H2,1H3 | | InChIKey | OSZHSESNQIMXMZ-UHFFFAOYSA-N | | SMILES | C1(CO)=CC=CC(OC)=C1O | | LogP | 0.543 (est) | | CAS DataBase Reference | 4383-05-5(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Hydroxy-3-methoxybenzyl alcohol(4383-05-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-36 | | WGK Germany | 3 | | HS Code | 2909500090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Hydroxy-3-methoxybenzyl alcohol Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | 2-Hydroxy-3-methoxybenzyl alcohol was employed as substrate, to investigate in vitro substrate specificity of UDP-glucose:p-hydroxymandelonitrile-O-glucosyltransferase from Sorghum bicolor (UGT85B1). |
| | 2-Hydroxy-3-methoxybenzyl alcohol Preparation Products And Raw materials |
|