|
|
| | 1-(2,4,6-Triisopropylphenylsulfonyl)imidazole Basic information |
| Product Name: | 1-(2,4,6-Triisopropylphenylsulfonyl)imidazole | | Synonyms: | 1-[(2,4,6-Triisopropylphenyl)sulfonyl]-1H-imidazole;1H-Imidazole, 1-[[2,4,6-tris(1-methylethyl)phenyl]sulfonyl]-;Imidazole, 1-[2,4,6-tris(1-methylethyl)phenylsulfonyl)-;N-(2,4,6-Triisopropylbenzenesulfonyl)imidazole;N-(2,4,6-TRIISOPROPYLBENZENESULPHONYL)IMIDAZOLE;1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylimidazole;1-(2,4,6-TRIISOPROPYLPHENYLSULFONYL)IMIDAZOLE;1-(2,4,6-TRIISOPROPYLBENZENESULFONYL)IMIDAZOLE | | CAS: | 50257-40-4 | | MF: | C18H26N2O2S | | MW: | 334.48 | | EINECS: | 256-509-5 | | Product Categories: | Biochemistry;Condensing Agents (DNA / RNA Synthesis);Nucleosides, Nucleotides & Related Reagents;Protecting Agents, Phosphorylating Agents & Condensing Agents;Protection & Derivatization Reagents (for Synthesis);Synthetic Organic Chemistry | | Mol File: | 50257-40-4.mol |  |
| | 1-(2,4,6-Triisopropylphenylsulfonyl)imidazole Chemical Properties |
| Melting point | 118-120 °C(lit.) | | Boiling point | 449.7±55.0 °C(Predicted) | | density | 1.13±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | almost transparency in Methanol | | pka | 0.65±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C18H26N2O2S/c1-12(2)15-9-16(13(3)4)18(17(10-15)14(5)6)23(21,22)20-8-7-19-11-20/h7-14H,1-6H3 | | InChIKey | AGGRGODMKWLSDE-UHFFFAOYSA-N | | SMILES | C1N(S(C2=C(C(C)C)C=C(C(C)C)C=C2C(C)C)(=O)=O)C=CN=1 | | CAS DataBase Reference | 50257-40-4(CAS DataBase Reference) | | NIST Chemistry Reference | 1-(2,4,6-Trisopropylbenzenesulfonyl)imidazole(50257-40-4) |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | HS Code | 2933.29.4300 |
| | 1-(2,4,6-Triisopropylphenylsulfonyl)imidazole Usage And Synthesis |
| Uses | 1-(2,4,6-Triisopropylphenylsulfonyl)imidazole is used for the coupling or condensation reagents used in oligonucleotide synthesis. |
| | 1-(2,4,6-Triisopropylphenylsulfonyl)imidazole Preparation Products And Raw materials |
|