- FMOC-GLU(ODMAB)-OH
-
- $1.00
-
2019-07-06
- CAS:268730-86-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | FMOC-GLU(ODMAB)-OH Basic information |
| Product Name: | FMOC-GLU(ODMAB)-OH | | Synonyms: | N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-glutamic acid 5-[[4-[[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)-3-methylbutyl]amino]phenyl]methyl] ester;Fmoc-Glu(odmab)-OH;(S)-2-(((9H-fluoren-9-yl)methyl9H-fluoren-9-yl)methoxy)carbonylamino)-5-(4-(1-(4,4-dimethyl-2,6-dioxocyclohexylidene)-3-methylbutylamino)benzyloxy)-5-oxopentanoic acid;Fmoc-L-glutamic acid gamma-4-[N-{1-(4,4-dimethyl-2,6-dioxocyclohexylidene)-3-methylbutyl}amino]benzyl ester;(2S)-5-[(4-{[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)-3-methylbutyl]amino}phenyl)methoxy]-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-5-oxopentanoic acid;Fmoc-L-Glu(ODmab)-OH;Fmoc-L-glutamic acid γ-4-[N-{1-(4,4-dimethyl-2,6-dioxocyclohexylidene)-3-methylbutyl}amino] benzyl ester≥ 98.5% (HPLC);(S)-2-((((9H-Fluoren-9-yl)Methoxy)carbonyl)aMino)-5-((4-((1-(4,4-diMethyl-2,6-dioxocyclohexylidene)-3-Methylbutyl)aMino)benzyl)oxy)-5-oxopentanoic acid | | CAS: | 268730-86-5 | | MF: | C40H44N2O8 | | MW: | 680.79 | | EINECS: | | | Product Categories: | | | Mol File: | 268730-86-5.mol |  |
| | FMOC-GLU(ODMAB)-OH Chemical Properties |
| Boiling point | 851.2±65.0 °C(Predicted) | | density | 1.251 | | storage temp. | Sealed in dry,2-8°C | | pka | 3.69±0.10(Predicted) | | form | powder | | Major Application | peptide synthesis | | InChIKey | DABQNXPVTHIRRK-YTTGMZPUSA-N | | SMILES | N([C@@H](CCC(=O)OCc4ccc(cc4)NC(=C5C(=O)CC(CC5=O)(C)C)CC(C)C)C(=O)O)C(=O)OCC1c2c(cccc2)c3c1cccc3 |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids |
| | FMOC-GLU(ODMAB)-OH Usage And Synthesis |
| Chemical Properties | White to pale yellow powder | | Uses | The ODmab group is an excellent protecting group for carboxylic acids. It is orthogonal to both acid. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-GLU(ODMAB)-OH Preparation Products And Raw materials |
|