|
|
| | 5-Chloro-2-hydroxy-4,6-dimethylnicotinonitrile Basic information | | Uses |
| Product Name: | 5-Chloro-2-hydroxy-4,6-dimethylnicotinonitrile | | Synonyms: | 5-CHLORO-4,6-DIMETHYL-2-HYDROXYPYRIDINE-3-CARBONITRILE;3-Pyridinecarbonitrile, 5-chloro-1,2-dihydro-4,6-dimethyl-2-oxo-;5-CHLORO-2-HYDROXY-4,6-DIMETHYLNICOTINO;5-chloro-4,6-dimethyl-2-oxo-1,2-dihydropyridine-3-carbonitrile;5-Chloro-2-hydroxy-4,6-dimethylnicotinonitrile | | CAS: | 23819-92-3 | | MF: | C8H7ClN2O | | MW: | 182.61 | | EINECS: | | | Product Categories: | | | Mol File: | 23819-92-3.mol |  |
| | 5-Chloro-2-hydroxy-4,6-dimethylnicotinonitrile Chemical Properties |
| Melting point | 275-278℃ | | Boiling point | 288.6℃ | | density | 1.31 | | Fp | 128.3℃ | | form | solid | | color | Off-white to pale yellow | | InChI | InChI=1S/C8H7ClN2O/c1-4-6(3-10)8(12)11-5(2)7(4)9/h1-2H3,(H,11,12) | | InChIKey | CEIUMKPKEXHJEN-UHFFFAOYSA-N | | SMILES | C1(=O)NC(C)=C(Cl)C(C)=C1C#N |
| | 5-Chloro-2-hydroxy-4,6-dimethylnicotinonitrile Usage And Synthesis |
| Uses | 5-Chloro-2-hydroxy-4,6-dimethylnicotinonitrile is a nitrile derivative that can be used as a pharmaceutical intermediate. | | Definition | ChEBI: 5-Chloro-2-hydroxy-4,6-dimethylnicotinonitrile is a nitrile and a member of pyridines. |
| | 5-Chloro-2-hydroxy-4,6-dimethylnicotinonitrile Preparation Products And Raw materials |
|