| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Methyl (2R,3S)-3-(benzoylamino)-2-hydroxy-3-phenylpropanoate Basic information |
| | Methyl (2R,3S)-3-(benzoylamino)-2-hydroxy-3-phenylpropanoate Chemical Properties |
| Melting point | 178-183℃ | | Boiling point | 540.3±50.0 °C(Predicted) | | density | 1.236±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Ethyl Acetate (Slightly, Heated), Methanol (Slightly) | | pka | 12.05±0.20(Predicted) | | form | Crystalline Powder | | color | White | | InChI | InChI=1/C17H17NO4/c1-22-17(21)15(19)14(12-8-4-2-5-9-12)18-16(20)13-10-6-3-7-11-13/h2-11,14-15,19H,1H3,(H,18,20)/t14-,15-/s3 | | InChIKey | UYJLJICUXJPKTB-YQUYYLCKNA-N | | SMILES | N(C(C1C=CC=CC=1)=O)[C@@H](C1C=CC=CC=1)[C@H](O)C(OC)=O |&1:9,16,r| | | CAS DataBase Reference | 32981-85-4(CAS DataBase Reference) |
| | Methyl (2R,3S)-3-(benzoylamino)-2-hydroxy-3-phenylpropanoate Usage And Synthesis |
| Chemical Properties | white crystal powder | | Uses | (2R,3S)-N-Benzoyl-3-phenyl Isoserine Methyl Ester is an intermediate in the preparation of potent anticancer drug Paclitaxel (P132500) used to study the location of the binding sites. |
| | Methyl (2R,3S)-3-(benzoylamino)-2-hydroxy-3-phenylpropanoate Preparation Products And Raw materials |
|