| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
(3-Bromo-2,4,6-trimethylphenylcarbamoyl)methyliminodiacetic acid manufacturers
- Mebrofenin
-
- $73.00
-
2026-04-20
- CAS:78266-06-5
- Purity: 99.88%
- Supply Ability: 10g
|
| | (3-Bromo-2,4,6-trimethylphenylcarbamoyl)methyliminodiacetic acid Basic information |
| Product Name: | (3-Bromo-2,4,6-trimethylphenylcarbamoyl)methyliminodiacetic acid | | Synonyms: | ((((3-bromomesityl)carbamoyl)methyl)imino)diaceticacid;cine;glycine,n-(2-((3-bromo-2,4,6-trimethylphenyl)amino)-2-oxoethyl)-n-(carboxymeth;n-(2-((3-bromo-2,4,6-trimethylphenyl)amino)-2-oxoethyl)-n-(carboxymethyl)gly;tc-99m-tmbida;SQ26962;N-[2-[(3-BROMO-2,4,6-TRIMETHYLPHENYL)-AMINO]-2-OXOETHYL]-N-(CARBOXYMETHYL)-GLYCINE;N-(3-BROMO-2,4,6-TRIMETHYLPHENYLCARBAMOYLMETHYL)IMINODIACETIC ACID | | CAS: | 78266-06-5 | | MF: | C15H19BrN2O5 | | MW: | 387.23 | | EINECS: | 278-877-6 | | Product Categories: | | | Mol File: | 78266-06-5.mol |  |
| | (3-Bromo-2,4,6-trimethylphenylcarbamoyl)methyliminodiacetic acid Chemical Properties |
| Melting point | 193-198 °C | | Boiling point | 577.4±50.0 °C(Predicted) | | density | 1.5766 (rough estimate) | | refractive index | 1.6520 (estimate) | | storage temp. | 2-8°C | | pka | 1.68±0.10(Predicted) | | form | Solid | | color | White to off-white | | Water Solubility | Soluble in dimethylsulphoxide and ethanol. Insoluble in water. | | BRN | 10474727 | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C15H19BrN2O5/c1-8-4-9(2)15(10(3)14(8)16)17-11(19)5-18(6-12(20)21)7-13(22)23/h4H,5-7H2,1-3H3,(H,17,19)(H,20,21)(H,22,23) | | InChIKey | MHPZZZZLAQGTHT-UHFFFAOYSA-N | | SMILES | Brc1c(c(c(cc1C)C)NC(=O)CN(CC(=O)O)CC(=O)O)C |
| Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | WGK 3 | | RTECS | MB9121850 | | HS Code | 2924296000 | | Storage Class | 11 - Combustible Solids | | Toxicity | LD50 in mice, rats (mg/kg): 213.8, 226.4 i.v. (Jiang) |
| | (3-Bromo-2,4,6-trimethylphenylcarbamoyl)methyliminodiacetic acid Usage And Synthesis |
| Chemical Properties | Colourless or brownish crystals | | Uses | Diagnostic aid (hepatobiliary function determination). | | Uses | (3-Bromo-2,4,6-trimethylphenylcarbamoyl)methyliminodiacetic acid is used in the diagnostic field of medicine and in the assessment of hepatobillary transport. | | Definition | ChEBI: Mebrofenin is an amino acid amide. |
| | (3-Bromo-2,4,6-trimethylphenylcarbamoyl)methyliminodiacetic acid Preparation Products And Raw materials |
|