|
|
| | 3-(3,5-DICHLOROPHENOXY)BENZALDEHYDE Basic information |
| | 3-(3,5-DICHLOROPHENOXY)BENZALDEHYDE Chemical Properties |
| Melting point | 48-55 °C (lit.) | | Boiling point | 125 °C/0.03 mmHg (lit.) | | density | 1.3001 (rough estimate) | | refractive index | 1.4730 (estimate) | | Fp | >230 °F | | storage temp. | 2-8°C, stored under nitrogen | | form | crystalline powder | | color | Pale lemon | | InChI | 1S/C13H8Cl2O2/c14-10-5-11(15)7-13(6-10)17-12-3-1-2-9(4-12)8-16/h1-8H | | InChIKey | BISWHYILBVQCRA-UHFFFAOYSA-N | | SMILES | Clc1cc(Cl)cc(Oc2cccc(C=O)c2)c1 |
| Hazard Codes | Xn,N | | Risk Statements | 22-41-43-50/53 | | Safety Statements | 26-36/37/39-60-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | HazardClass | 9 | | HS Code | 29130000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Skin Sens. 1 |
| | 3-(3,5-DICHLOROPHENOXY)BENZALDEHYDE Usage And Synthesis |
| Uses | 3-(3,5-Dichlorophenoxy)benzaldehyde was used in the synthesis of 3-(3,5-dichlorophenoxy)-nitrostyrene (DPNS). |
| | 3-(3,5-DICHLOROPHENOXY)BENZALDEHYDE Preparation Products And Raw materials |
|