|
|
| | 3',5-Dihydroxy-7-(β-D-glucopyranosyloxy)-4'-methoxyflavone Basic information |
| | 3',5-Dihydroxy-7-(β-D-glucopyranosyloxy)-4'-methoxyflavone Chemical Properties |
| Melting point | 253-255℃ | | Boiling point | 803.6±65.0 °C(Predicted) | | density | 1.609 | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 6.10±0.40(Predicted) | | form | powder | | color | Yellow | | InChIKey | WKUHPOMCLBLCOV-YFUKJJPONA-N | | SMILES | C1(C2=CC=C(OC)C(O)=C2)OC2=C(C(O)=CC(O[C@H]3[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O3)=C2)C(=O)C=1 |&1:18,19,21,23,25,r| |
| | 3',5-Dihydroxy-7-(β-D-glucopyranosyloxy)-4'-methoxyflavone Usage And Synthesis |
| Chemical Properties | Yellow powder, soluble in organic solvents such as methanol, ethanol, DMSO, etc., derived from lemon, geranium bark, and chrysanthemum. | | Uses | Diosmetin-7-o-β-D-glucopyranoside is a metabolite of Diosmetin (D485000) a metabolite of Apigenin. Antibacterial. | | Definition | ChEBI: Diosmetin 7-O-beta-D-glucopyranoside is a glycoside and a member of flavonoids. |
| | 3',5-Dihydroxy-7-(β-D-glucopyranosyloxy)-4'-methoxyflavone Preparation Products And Raw materials |
|