| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (R)-(+)-alpha-Methyl-2-naphthalenemethanol Basic information |
| | (R)-(+)-alpha-Methyl-2-naphthalenemethanol Chemical Properties |
| Melting point | 68-70 °C (lit.) | | Boiling point | 316.049±11.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.113 | | refractive index | 40 ° (C=1, MeOH) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol,Toluene | | form | powder to crystal | | pka | 14.359±0.20(predicted) | | color | White to Almost white | | Optical Rotation | [α]20/D +38°, c = 5 in ethanol | | BRN | 3195952 | | InChI | InChI=1/C12H12O/c1-9(13)11-7-6-10-4-2-3-5-12(10)8-11/h2-9,13H,1H3/t9-/s3 | | InChIKey | AXRKCRWZRKETCK-DJEYLCQNNA-N | | SMILES | C12C=CC=CC1=CC=C([C@H](O)C)C=2 |&1:9,r| |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2906.29.6000 | | Storage Class | 11 - Combustible Solids |
| | (R)-(+)-alpha-Methyl-2-naphthalenemethanol Usage And Synthesis |
| Uses | (R)-(+)-1-(2-Naphthyl)ethanol may be used to synthesize (S)-2-chloro-1-phenylethanol by reacting with 2-chloroacetophenone in the presence of a chiral bidentate titanium Lewis acid catalyst. | | Application | (R)-(+)-1-(2-Naphthyl)ethanol is a useful research chemical. |
| | (R)-(+)-alpha-Methyl-2-naphthalenemethanol Preparation Products And Raw materials |
|