|
|
| | (R)-2-(1-HYDROXYETHYL)PYRIDINE Basic information |
| | (R)-2-(1-HYDROXYETHYL)PYRIDINE Chemical Properties |
| Boiling point | 210.6±15.0 °C(Predicted) | | density | 1.082±0.06 g/cm3(Predicted) | | refractive index | n20/D 1.528 | | storage temp. | Inert atmosphere,2-8°C | | pka | 13.55±0.20(Predicted) | | form | Solid | | color | Pink | | Water Solubility | Soluble in ethanol and water. | | InChI | InChI=1/C7H9NO/c1-6(9)7-4-2-3-5-8-7/h2-6,9H,1H3/t6-/s3 | | InChIKey | PPHIIIRFJKDTLG-ISZMHOAENA-N | | SMILES | N1C=CC=CC=1[C@@H](C)O |&1:6,r| |
| | (R)-2-(1-HYDROXYETHYL)PYRIDINE Usage And Synthesis |
| Chemical Properties | white crystals | | Uses | (1R)-1-(2-Pyridinyl)ethanol is a building block used in the synthesis of highly potent and selective chiral inhibitors of PDE5. |
| | (R)-2-(1-HYDROXYETHYL)PYRIDINE Preparation Products And Raw materials |
|