- Cis-3-Hexenyl Propionate
-
- $0.00 / 1KG
-
2026-04-20
- CAS:33467-74-2
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 30tons/month
|
| | CIS-3-HEXENYL PROPIONATE Basic information |
| | CIS-3-HEXENYL PROPIONATE Chemical Properties |
| Melting point | -57.45°C (estimate) | | Boiling point | 83 °C/17 mmHg(lit.) | | density | 0.887 g/mL at 25 °C(lit.) | | FEMA | 3933 | CIS-3-HEXENYL PROPIONATE | | refractive index | n20/D 1.43(lit.) | | Fp | 66 °C | | storage temp. | Inert atmosphere,Room Temperature | | Odor | at 100.00 %. green fresh fruity apple pear vegetable melon banana peach | | Appearance | Colorless to light yellow Liquid | | biological source | synthetic | | Odor Type | green | | JECFA Number | 1274 | | Major Application | flavors and fragrances | | Cosmetics Ingredients Functions | PERFUMING | | InChI | 1S/C9H16O2/c1-3-5-6-7-8-11-9(10)4-2/h5-6H,3-4,7-8H2,1-2H3/b6-5- | | InChIKey | LGTLDEUQCOJGFP-WAYWQWQTSA-N | | SMILES | [H]\C(CC)=C(/[H])CCOC(=O)CC | | LogP | 2.95 | | CAS DataBase Reference | 33467-74-2(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Hexen-1-ol, propanoate, (z)-(33467-74-2) | | EPA Substance Registry System | 3-Hexen-1-ol, propanoate, (3Z)- (33467-74-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 2 | | RTECS | MP8645100 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 | | Toxicity | rabbit,LD50,skin,> 5gm/kg (5000mg/kg),Food and Cosmetics Toxicology. Vol. 17, Pg. 805, 1979. |
| | CIS-3-HEXENYL PROPIONATE Usage And Synthesis |
| Chemical Properties | (Z)-3-Hexenyl propionate has a green, waxy odor with a vegetable character. | | Occurrence | Reported found in thyme, black tea, plum and fresh mango | | Uses | flavors and fragrances | | Definition | ChEBI: Cis-3-Hexenyl propanoate is a carboxylic ester. | | Taste threshold values | Taste characteristics at 5 ppm: green, apple and pear with an oily, waxy, slightly citrus note | | Synthesis | Cis-3-hexenyl propionate is prepared from cis-3-Hexenol and Propionicacid by azeotropic esterification. |
| | CIS-3-HEXENYL PROPIONATE Preparation Products And Raw materials |
|