|
|
| | 1-O-Hexadecyl-sn-glycerol Basic information |
| Product Name: | 1-O-Hexadecyl-sn-glycerol | | Synonyms: | 1,2-Propanediol, 3-(hexadecyloxy)-, (2S)-;α-hexadecylglyceryl ether;1-hexadecylglycerol;1-o-hexadecylglycerol;3-(hexadecyloxy)-2-propanediol;1-O-PALMITOYL-SN-GLYCEROL;MONOCERYL GLYCERYL ETHER;(S)-3-(hexadecyloxy)propane-1,2-diol | | CAS: | 506-03-6 | | MF: | C19H40O3 | | MW: | 316.52 | | EINECS: | 208-026-6 | | Product Categories: | | | Mol File: | 506-03-6.mol |  |
| | 1-O-Hexadecyl-sn-glycerol Chemical Properties |
| Melting point | 64° | | alpha | D20 +3.0° (c = 1.16 in chloroform) | | Boiling point | bp0.005 120° | | density | 1.0054 (rough estimate) | | refractive index | 1.4410 (estimate) | | storage temp. | -15°C | | solubility | DMF: 16 mg/ml; DMSO: 0.16 mg/ml; Ethanol: 5 mg/ml | | form | A crystalline solid | | pka | 13.68±0.20(Predicted) | | Cosmetics Ingredients Functions | SKIN CONDITIONING
VISCOSITY CONTROLLING
SKIN CONDITIONING - EMOLLIENT | | InChI | InChI=1S/C19H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-22-18-19(21)17-20/h19-21H,2-18H2,1H3/t19-/m0/s1 | | InChIKey | OOWQBDFWEXAXPB-IBGZPJMESA-N | | SMILES | C(O)[C@H](O)COCCCCCCCCCCCCCCCC | | LogP | 6.702 (est) |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 1-O-Hexadecyl-sn-glycerol Usage And Synthesis |
| Description | 1-O-Hexadecyl-sn-glycerol is a bioactive alkyl glyceryl ether. It reduces UVB-induced cell death and production of reactive oxygen species (ROS) and prostaglandin E2 (PGE2; ) in normal human epidermal keratinocytes (NHEKs). 1-O-Hexadecyl-sn-glycerol (50 μM) increases coronary flow and left ventricular developed pressure and reduces malondialdehyde (MDA) formation ex vivo in a rat heart model of ischemia/reperfusion injury. | | Uses | 1-O-Hexadecyl-sn-glycerol restores plasmalogen levels in Chinese hamster ovary (CHO) cells and human pulmonary arterial endothelial cells (PAEC). Plasmalogen may play a role in protecting animal cells against photosensitized killing. | | Definition | ChEBI: A 1-n-hexadecyl analogue of an optically active alkylglycerol compound. | | Purification Methods | Recrystallise it from hexane. [Beilstein 1 III 2322.] | | References | [1] MARIKO YOKOTA. Chimyl Alcohol Suppresses PGE2 Synthesis by Human Epidermal Keratinocytes through the Activation of PPAR-γ.[J]. Journal of oleo science, 2018, 67 4: 455-462. DOI: 10.5650/jos.ess17157
[2] N MAULIK. Myocardial salvage by chimyl alcohol: possible role of peroxisomal dysfunction in reperfusion injury.[J]. Annals of the New York Academy of Sciences, 1994, 723: 380-384.
|
| | 1-O-Hexadecyl-sn-glycerol Preparation Products And Raw materials |
|