- FMOC-ASP(OALL)-OH
-
- $1.00
-
2019-07-06
- CAS:146982-24-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
- FMOC-ASP(OALL)-OH
-
- $7.00
-
2019-07-06
- CAS: 146982-24-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100KG
|
| | FMOC-ASP(OALL)-OH Basic information |
| | FMOC-ASP(OALL)-OH Chemical Properties |
| Melting point | 111-115 °C | | Boiling point | 638.5±55.0 °C(Predicted) | | density | 1.286±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in water or 1% acetic acid | | form | Solid | | pka | 3.59±0.23(Predicted) | | color | White to off-white | | Optical Rotation | [α]20/D 27±2°, c = 1% in DMF | | Water Solubility | Slightly soluble in water. | | BRN | 6670219 | | Major Application | peptide synthesis | | InChI | 1S/C22H21NO6/c1-2-11-28-20(24)12-19(21(25)26)23-22(27)29-13-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h2-10,18-19H,1,11-13H2,(H,23,27)(H,25,26)/t19-/m0/s1 | | InChIKey | FBNFRRNBFASDKS-IBGZPJMESA-N | | SMILES | OC(=O)[C@H](CC(=O)OCC=C)NC(=O)OCC1c2ccccc2-c3ccccc13 | | CAS DataBase Reference | 146982-24-3(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2924 29 70 | | Storage Class | 11 - Combustible Solids |
| | FMOC-ASP(OALL)-OH Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | Fmoc-Asp(OAll)-OH, is an amino acid building block used in peptide synthesis. With a growing peptide drug market the fast, reliable synthesis of peptides is of great importance. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-ASP(OALL)-OH Preparation Products And Raw materials |
|