|
|
| | 1,4-Bis(trimethylsilyl)benzene Basic information |
| Product Name: | 1,4-Bis(trimethylsilyl)benzene | | Synonyms: | 1,4-BIS(TRIMETHYLSILYL)BENZENE;Benzene, p-bis(trimethylsilyl)-;p-Bis(trimethylsilyl)benzene;p-phenylenebis(trimethyl-silan;p-Phenylenebis(trimethylsilane);Silane, 1,4-phenylenebis*trimethyl-;Silane, p-phenylenebis*trimethyl-;Silane, p-phenylenebis[trimethyl- | | CAS: | 13183-70-5 | | MF: | C12H22Si2 | | MW: | 222.47 | | EINECS: | 219-638-8 | | Product Categories: | Industrial/Fine Chemicals | | Mol File: | 13183-70-5.mol |  |
| | 1,4-Bis(trimethylsilyl)benzene Chemical Properties |
| Melting point | 91-94 °C(lit.) | | Boiling point | 194 °C742 mm Hg(lit.) | | density | 0.85±0.1 g/cm3(Predicted) | | Fp | 175 °C | | storage temp. | 2-8°C | | form | solid | | color | White to Light yellow | | Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems | | BRN | 1867055 | | InChI | 1S/C12H22Si2/c1-13(2,3)11-7-9-12(10-8-11)14(4,5)6/h7-10H,1-6H3 | | InChIKey | NVRBTKMAZQNKPX-UHFFFAOYSA-N | | SMILES | C[Si](C)(C)c1ccc(cc1)[Si](C)(C)C | | CAS DataBase Reference | 13183-70-5(CAS DataBase Reference) | | NIST Chemistry Reference | Silane, 1,4-phenylenebis[trimethyl-(13183-70-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | RTECS | VV4850000 | | F | 10-21 | | TSCA | No | | HS Code | 2931.90.9010 | | Storage Class | 11 - Combustible Solids | | Toxicity | mouse,LD50,intravenous,180mg/kg (180mg/kg),U.S. Army Armament Research & Development Command, Chemical Systems Laboratory, NIOSH Exchange Chemicals. Vol. NX#02576, |
| | 1,4-Bis(trimethylsilyl)benzene Usage And Synthesis |
| Chemical Properties | white crystalline powder and chunks | | Uses | 1,4-Bis(trimethylsilyl)benzene (TMSB) can be used:
- As a precursor for developing silicon carbide coating using plasma-assisted chemical vapor deposition (CVD) process.
- As a secondary standard in quantitative NMR (qNMR) spectroscopy.
- As an internal standard for quantitation of small organic molecules in DMSO-d6 solution by 1H NMR spectroscopy.
|
| | 1,4-Bis(trimethylsilyl)benzene Preparation Products And Raw materials |
|