- UNC926
-
- $30.00
-
2026-07-14
- CAS:1184136-10-4
- Purity: 97.22%
- Supply Ability: 10g
- UNC-926 Hydochloride
-
- $1.00
-
2019-12-24
- CAS:1184136-10-4
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 20kg
|
| | UNC-926 Hydochloride Basic information |
| | UNC-926 Hydochloride Chemical Properties |
| storage temp. | 2-8°C | | solubility | DMSO: soluble2mg/mL, clear (warmed) | | form | powder | | color | white to light brown | | InChI | InChI=1S/C16H21BrN2O/c17-14-5-3-4-13(12-14)16(20)19-10-6-15(7-11-19)18-8-1-2-9-18/h3-5,12,15H,1-2,6-11H2 | | InChIKey | OWGLFIKZKQOYHZ-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC(Br)=C1)(N1CCC(N2CCCC2)CC1)=O |
| | UNC-926 Hydochloride Usage And Synthesis |
| Uses | UNC-926 is a methyl-lysine reader antagonist; binds to the MBT domain of the L3MBTL1 protein (Kd = 3.9 μM). UNC-926 selectively inhibits the interaction between L3MBTL13XMBT-H4K20me1 in a peptide pull down assay. |
| | UNC-926 Hydochloride Preparation Products And Raw materials |
|