- DavePhos-Pd-G3
-
- $2.00
-
2026-08-25
- CAS:1445085-87-9
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| | DavePhos-Pd-G3 Basic information |
| Product Name: | DavePhos-Pd-G3 | | Synonyms: | Methanesulfonato[2-(dicyclohexylphosphino)-2'-(N,N-diMethylaMino)-1,1'-biphenyl](2'-aMino-1,1'-biphenyl-2-yl)palladiuM(II) CH2Cl2 adduct, Min. 98% [DavePhos Palladacycle];DavePhos-Pd-G3 AldrichCPR;Methanesulfonato[2-(dicyclohexylphosphino)-2'-(N,N-dimethylamino)-1,1'-biphenyl](2'-amino-1,1'-biphenyl-2-yl)palladium(II) CH2Cl2 adduct;METHANESULFONATO[2-(DICYCLOHEXYLPHOSPHINO)-2'-(N,N-DIMETHYLAMINO)-1,1'-BIPHENYL](2'-AMINO-1,1'-BIPHENYL-2-YL)PALLADIUM(II)CH2CL2ADDUCT,MIN.98%[DAVEPHOSPALLADACYCLEGEN.3];[2-(dicyclohexylphosphino)-2-(N,N-dimethylamino)-1,1-biphenyl]-2-(2-amino-1,1-biphenyl)]palladium(II) methanesulfonate;Methanesulfonato[2-(dicyclohexylphosphino)-2'-(N,N-dimethylamino)-1,1'-biphenyl](2'-amino-1,1'-biphenyl-2-yl)palladium(II) CH2Cl2 adduct,[DavePhos Palladacycle Gen. 3];Methanesulfonato[2-(dicyclohexylphosphino)-2'-(N,N-diMethylaMino)-1,1'-biphenyl](2'-aMino-1,1'-biphenyl-2-yl)palladiuM(II) CH2Cl2 adduct [DavePhos Palladacycle];Methanesulfonato[2-(dicyclohexylphosphino)-2'-(N,N-dimethylamino)1,1'-biphenyl](2'-amino-1,1'-biphenyl-2-yl)palladium(II) | | CAS: | 1445085-87-9 | | MF: | C39H49N2O3PPdS | | MW: | 763.29 | | EINECS: | | | Product Categories: | Buchwald Ligands&Precatalysts;Buchwald Precatalysts Series;Pd | | Mol File: | 1445085-87-9.mol |  |
| | DavePhos-Pd-G3 Chemical Properties |
| Melting point | 183-200°C (decomp) | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | Powder | | color | white | | InChIKey | LPLXTNDHFXGKKB-UHFFFAOYSA-N | | SMILES | P(C1CCCCC1)(C1CCCCC1)(C1C=CC=CC=1C1C=CC=CC=1N(C)C)[Pd+2]1(NC2=CC=CC=C2C2=CC=CC=[C-]12)[O-]S(=O)(=O)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Carc. 2 |
| | DavePhos-Pd-G3 Usage And Synthesis |
| Uses | Pd precatalyst for cross-coupling | | General Description | DavePhos-Pd-G3 is a modified G3 precatalyst (G3′). It has been synthesized by Buchwald and coworkers from second generation (G2) precatalyst by methylation of the amino group present on biphenyl backbone. It is a useful catalyst for various cross-coupling reactions. They are versatile catalysts. They have long life in solutions and are readily soluble in various organic solvents. G3- precatalysts have been employed in various C-N bond forming reactions. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Cross Couplings
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst |
| | DavePhos-Pd-G3 Preparation Products And Raw materials |
|