| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Quinuclidine hydrochloride manufacturers
|
| | Quinuclidine hydrochloride Basic information |
| Product Name: | Quinuclidine hydrochloride | | Synonyms: | 1-AZABICYCLO[2.2.2]OCTANE HYDROCHLORIDE;QUINUCLIDINE HYDROCHLORIDE 98+%;QuinuclidineHCl;1,4-Ethylenepiperidine hydrochloride;Quinuclidin-1-ium chloride;1-azabiscyclo[2.2.2]octylalkanehydrochloride;Quinuclidine hydrochloride | | CAS: | 39896-06-5 | | MF: | C7H14ClN | | MW: | 147.65 | | EINECS: | 254-682-1 | | Product Categories: | | | Mol File: | 39896-06-5.mol |  |
| | Quinuclidine hydrochloride Chemical Properties |
| Melting point | >300 °C(lit.) | | solubility | H2O: 0.1 g/mL, clear | | form | powder to crystal | | color | White to Almost white | | Merck | 14,8081 | | BRN | 3675063 | | InChI | InChI=1S/C7H13N.ClH/c1-4-8-5-2-7(1)3-6-8;/h7H,1-6H2;1H | | InChIKey | BZLBBZLOMXKMTA-UHFFFAOYSA-N | | SMILES | C12CCN(CC1)CC2.Cl |
| Safety Statements | 22-24/25 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | HS Code | 2933.39.6190 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects |
| | Quinuclidine hydrochloride Usage And Synthesis |
| Uses | Quinuclidine hydrochloride was used in the synthesis of quinuclidine adducts with group 13 trihydride molecules, MH3 (M = B, Al) and their structure elucidation by gas-phase electron diffraction and quantum chemical calculations. It was used to investigate series of organic hydrochloride salts by solid-state 35Cl and 37Cl NMR spectroscopy. | | General Description | Quinuclidine stabilises the group 13 trihydrides, particularly for use in chemical vapour deposition techniques. |
| | Quinuclidine hydrochloride Preparation Products And Raw materials |
|