| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | N-tert-Butoxycarbonyl-4-cyanophenyl-D-alanine Basic information |
| | N-tert-Butoxycarbonyl-4-cyanophenyl-D-alanine Chemical Properties |
| Melting point | 152.6 °C | | Boiling point | 432.4°C (rough estimate) | | density | 1.1611 (rough estimate) | | refractive index | 1.6280 (estimate) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 3.73±0.10(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | Consistent with structure | | BRN | 9339089 | | Major Application | peptide synthesis | | InChI | 1S/C15H18N2O4/c1-15(2,3)21-14(20)17-12(13(18)19)8-10-4-6-11(9-16)7-5-10/h4-7,12H,8H2,1-3H3,(H,17,20)(H,18,19)/t12-/m1/s1 | | InChIKey | RMBLTLXJGNILPG-GFCCVEGCSA-N | | SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccc(cc1)C#N)C(O)=O | | CAS DataBase Reference | 146727-62-0(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36/37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HazardClass | 6.1 | | HS Code | 29223900 | | Storage Class | 11 - Combustible Solids |
| | N-tert-Butoxycarbonyl-4-cyanophenyl-D-alanine Usage And Synthesis |
| Chemical Properties | off-white powder | | Uses | N-Boc-4-cyano-D-phenylalanine is used as pharmaceutical intermediate. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | N-tert-Butoxycarbonyl-4-cyanophenyl-D-alanine Preparation Products And Raw materials |
|