| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Fmoc-2-aminobenzoic acid Basic information |
| | Fmoc-2-aminobenzoic acid Chemical Properties |
| Melting point | 216-218 °C(lit.) | | Boiling point | 537.6±33.0 °C(Predicted) | | density | 1.352±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Dimethylformamide | | pka | 3.60±0.36(Predicted) | | form | Powder | | color | White to off-white | | Water Solubility | Soluble in water or 1% acetic acid. | | BRN | 7659726 | | Major Application | peptide synthesis | | InChI | 1S/C22H17NO4/c24-21(25)18-11-5-6-12-20(18)23-22(26)27-13-19-16-9-3-1-7-14(16)15-8-2-4-10-17(15)19/h1-12,19H,13H2,(H,23,26)(H,24,25) | | InChIKey | CNAVPEPPAVHHKN-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccccc1NC(=O)OCC2c3ccccc3-c4ccccc24 | | CAS DataBase Reference | 150256-42-1(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-2-aminobenzoic acid Usage And Synthesis |
| Chemical Properties | Beige powder | | Uses | It is a important organic intermediate. It can be used in agrochemical, pharmaceutical and dyestuff field | | Definition | ChEBI: 2-{[(9H-9-fluorenylmethoxy)carbonyl]amino}benzoic acid is a member of fluorenes. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-2-aminobenzoic acid Preparation Products And Raw materials |
|