| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1,4-Benzodioxane-6-boronic acid Basic information |
| Product Name: | 1,4-Benzodioxane-6-boronic acid | | Synonyms: | 1,4-Benzodioxane-6-boronic acid ,97%;(1,4-BENZODIOXAN-6-YL)BORONIC ACID;1,4-BENZODIOXANE-6-BORONIC ACID;2,3-DIHYDROBENZO[B][1,4]DIOXIN-6-YLBORONIC ACID;2,3-DIHYDRO-1,4-BENZODIOXIN-6-YLBORONIC ACID;3,4-(ETHYLENEDIOXY)BENZENEBORONIC ACID;1,4-benzodioxan-6-boronic acid;2,3-Dihydro-1,4-benzodioxine-6-boronic acid | | CAS: | 164014-95-3 | | MF: | C8H9BO4 | | MW: | 179.97 | | EINECS: | 625-755-9 | | Product Categories: | Boronic acids;Alkoxy;Aryl;Organoborons | | Mol File: | 164014-95-3.mol |  |
| | 1,4-Benzodioxane-6-boronic acid Chemical Properties |
| Melting point | 187 °C | | Boiling point | 361.0±52.0 °C(Predicted) | | density | 1.35±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder | | pka | 8.52±0.20(Predicted) | | color | white to off-white | | BRN | 7478648 | | InChI | InChI=1S/C8H9BO4/c10-9(11)6-1-2-7-8(5-6)13-4-3-12-7/h1-2,5,10-11H,3-4H2 | | InChIKey | SQDUGGGBJXULJR-UHFFFAOYSA-N | | SMILES | B(C1=CC=C2OCCOC2=C1)(O)O | | CAS DataBase Reference | 164014-95-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37-37/39 | | WGK Germany | 3 | | TSCA | No | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,4-Benzodioxane-6-boronic acid Usage And Synthesis |
| Chemical Properties | White to light yellow crystal powder | | Uses | Reactant involved in:
- Addition reactions with 1,8-naphthyridine N-oxides
- Iodocyclization and palladium-catalyzed coupling reactions for synthesis of pyranoquinolines
- Suzuki coupling reactions for synthesis of combretastatin analogs
- Suzuki-Miyaura coupling reactions for synthesis of aryl-substituted oxabenzindoles and methanobenzindoles
- Palladium-catalyzed oxyarylation of Heck reaction intermediates
- C-H functionalization of quinones
|
| | 1,4-Benzodioxane-6-boronic acid Preparation Products And Raw materials |
|