|
|
| | Bis(triethoxysilyl)methane Basic information |
| Product Name: | Bis(triethoxysilyl)methane | | Synonyms: | Bis(triethoxysilyl)methane ,97%;triethoxy(triethoxysilylmethyl)silane;3,7-Dioxa-4,6-disilanonane, 4,4,6,6-tetraethoxy-;riethoxy(triethoxysilylmethyl)silane;1,1,1,3,3,3-Hexaethoxy-1,3-disilapropane;4,4,6,6-Tetraethoxy-3,7-dioxa-4,6-disilanonane;DK189;Bis(triethoxysilyl)methane | | CAS: | 18418-72-9 | | MF: | C13H32O6Si2 | | MW: | 340.56 | | EINECS: | | | Product Categories: | | | Mol File: | 18418-72-9.mol |  |
| | Bis(triethoxysilyl)methane Chemical Properties |
| Melting point | <0°C | | Boiling point | 114 °C | | density | 0.974 | | refractive index | 1.4098 | | Fp | >65°C | | storage temp. | Store at room temperature | | Specific Gravity | 0.974 | | Appearance | Colorless to light yellow Liquid | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | InChI=1S/C13H32O6Si2/c1-7-14-20(15-8-2,16-9-3)13-21(17-10-4,18-11-5)19-12-6/h7-13H2,1-6H3 | | InChIKey | NIINUVYELHEORX-UHFFFAOYSA-N | | SMILES | CCO[Si](OCC)(OCC)C[Si](OCC)(OCC)OCC |
| | Bis(triethoxysilyl)methane Usage And Synthesis |
| Uses | Bis(triethoxysilyl)methane can be used to prepare gas separation membranes. |
| | Bis(triethoxysilyl)methane Preparation Products And Raw materials |
|