- HEXAETHYLDISILOXANE
-
-
2026-08-18
- CAS:994-49-0
- Min. Order: 1KG
- Purity: 98.00%
- Supply Ability: 1000KG /month
|
| | HEXAETHYLDISILOXANE Basic information |
| Product Name: | HEXAETHYLDISILOXANE | | Synonyms: | 1,1,1,3,3,3-hexaethyl-disiloxane;Disiloxane, hexaethyl-;hexaethyl-disiloxan;HEXAETHYLDISILOXANE;1,1,1,3,3,3-Hexaethylpropanedisiloxane;Bis(triethylsilyl) ether;Bis(triethylsilyl) oxide;Oxybis(triethylsilane) | | CAS: | 994-49-0 | | MF: | C12H30OSi2 | | MW: | 246.54 | | EINECS: | 213-619-8 | | Product Categories: | | | Mol File: | 994-49-0.mol |  |
| | HEXAETHYLDISILOXANE Chemical Properties |
| Melting point | -115°C | | Boiling point | 231 °C | | density | 0.844 | | refractive index | 1.4330 | | Fp | 87°C | | storage temp. | Sealed in dry,Room Temperature | | Specific Gravity | 0.844 | | Appearance | Colorless to light yellow Liquid | | Water Solubility | Not miscible or difficult to mix with water. | | Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems | | BRN | 1750865 | | InChI | InChI=1S/C12H30OSi2/c1-7-14(8-2,9-3)13-15(10-4,11-5)12-6/h7-12H2,1-6H3 | | InChIKey | WILBTFWIBAOWLN-UHFFFAOYSA-N | | SMILES | [Si](CC)(CC)(CC)O[Si](CC)(CC)CC | | CAS DataBase Reference | 994-49-0(CAS DataBase Reference) | | EPA Substance Registry System | Disiloxane, hexaethyl- (994-49-0) |
| Provider | Language |
|
ALFA
| English |
| | HEXAETHYLDISILOXANE Usage And Synthesis |
| Uses | Hexaethyldisiloxane is used as a pharmaceutical intermediate. |
| | HEXAETHYLDISILOXANE Preparation Products And Raw materials |
|