- FMOC-GLY-GLY-GLY-OH
-
- $60.00
-
2026-08-16
- CAS:170941-79-4
- Min. Order: 1KG
- Purity: 0.98
- Supply Ability: 20 tons
- Fmoc-Gly-Gly-Gly-OH
-
-
2025-06-07
- CAS:170941-79-4
- Min. Order: 100g
- Purity: >95.00%
- Supply Ability: 100g
|
| | FMOC-GLY-GLY-GLY-OH Basic information |
| Product Name: | FMOC-GLY-GLY-GLY-OH | | Synonyms: | FMOC-GLYCYL-GLYCYL-GLYCINE;FMOC-GLY-GLY-GLY-OH;2-[2-(2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]-amino}acetamido)acetamido]acetic acid;N-[N-[N-[(9H-Fluoren-9-ylmethoxy)carbonyl]glycyl]glycyl]-glycine;US20110097275 PAGE;1-(9H-Fluoren-9-yl)-3,6,9-trioxo-2-oxa-4,7,10-triazadodecan-12-oic acid;N-[(9H-fluoren-9-ylmethoxy)carbonyl]glycylglycylGlycine;Fmoc-Gly-Gly-Gly-OH≥ 97% (HPLC) | | CAS: | 170941-79-4 | | MF: | C21H21N3O6 | | MW: | 411.41 | | EINECS: | | | Product Categories: | | | Mol File: | 170941-79-4.mol |  |
| | FMOC-GLY-GLY-GLY-OH Chemical Properties |
| Boiling point | 811.8±65.0 °C(Predicted) | | density | 1.354±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 3.33±0.10(Predicted) | | form | powder or crystals | | color | white to off-white | | SMILES | O=C(OCC1C=2C=CC=CC2C=3C=CC=CC31)NCC(=O)NCC(=O)NCC(=O)O |
| WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | FMOC-GLY-GLY-GLY-OH Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Fmoc-Gly-Gly-Gly-OH is a tripeptide that can be used in peptide synthesis. |
| | FMOC-GLY-GLY-GLY-OH Preparation Products And Raw materials |
|