- Nitrobenzene-D5
-
- $0.00 / 5mg
-
2026-04-17
- CAS:4165-60-0
- Min. Order:
- Purity:
- Supply Ability: 10g
- NITROBENZENE-D5
-
- $2.00 / 1KG
-
2025-12-12
- CAS:4165-60-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 36900KG
|
| | NITROBENZENE-D5 Basic information |
| Product Name: | NITROBENZENE-D5 | | Synonyms: | Nitrobenzene-d5, 99 atom % d, for NMR;1-Nitro(2,3,4,5,6-2H5)benzene;Nitrobenzene-d5,for NMR,99 atom % D;Nitrobenzene-d5, 99% (Isotopic);Nitrobenzene-d5 solution;Perdeuteronitrobenzene;NITROBENZENE-D5 DEUTERATION MAGNISOLV(TM;Nitrobenzene-d5 | | CAS: | 4165-60-0 | | MF: | C6D5NO2 | | MW: | 128.14 | | EINECS: | 224-014-3 | | Product Categories: | 600 Series Wastewater Methods;EPA;Method 625 | | Mol File: | 4165-60-0.mol |  |
| | NITROBENZENE-D5 Chemical Properties |
| Melting point | 6°C | | Boiling point | 88 °C12 mm Hg(lit.) | | density | 1.253 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.5498(lit.) | | Fp | 190 °F | | storage temp. | 2-8°C | | solubility | 1.9g/l | | form | Liquid | | color | Clear colorless to yellow | | PH | 8.1 (1g/l, H2O, 20℃) | | explosive limit | 1.8-40%(V) | | BRN | 1455693 | | Henry's Law Constant | 8.5×10-1 mol/(m3Pa) at 25℃, Hiatt (2013) | | Stability: | Stable. Hygroscopic. Combustible. Incompatible with strong oxidizing agents, strong reducing agents, strong bases. | | InChI | 1S/C6H5NO2/c8-7(9)6-4-2-1-3-5-6/h1-5H/i1D,2D,3D,4D,5D | | InChIKey | LQNUZADURLCDLV-RALIUCGRSA-N | | SMILES | [2H]c1c([2H])c([2H])c(c([2H])c1[2H])[N+]([O-])=O | | CAS DataBase Reference | 4165-60-0(CAS DataBase Reference) | | EPA Substance Registry System | Nitrobenzene-d5 (4165-60-0) | | CAS Number Unlabeled | 98-95-3 |
| | NITROBENZENE-D5 Usage And Synthesis |
| Chemical Properties | clear colourless to yellow liquid | | Uses | (Nitrobenzene-d5) Labelled Nitrobenzene, used mainly in the production of the chemical precursor aniline. | | Definition | ChEBI: Nitrobenzene-d5 is a deuterated compound, a nitroarene and a C-nitro compound. | | General Description | Nitrobenzene-d5 solution is an internal/surrogate standard specifically designed for monitoring organic chemicals on the Priority Pollutants List in municipal and industrial wastewater, per methods developed by the US EPA Environmental Monitoring Systems Laboratory in Cincinnati, Ohio (EMSL-CI), under the authority of the Clean Water Act (CWA). |
| | NITROBENZENE-D5 Preparation Products And Raw materials |
|