- 3,3-Diphenyl-d-alanine
-
- $0.00 / 1KG
-
2022-02-09
- CAS:149597-91-1
- Min. Order: 1KG
- Purity: 97.2%
- Supply Ability: 100 tons
- 3,3-Diphenyl-D-alanine
-
- $7.00 / 1KG
-
2019-09-02
- CAS:149597-91-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: JD 365
|
| | 3,3-Diphenyl-D-alanine Basic information |
| | 3,3-Diphenyl-D-alanine Chemical Properties |
| Boiling point | 389.2±30.0 °C(Predicted) | | density | 1.198±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 2.11±0.10(Predicted) | | form | powder | | Appearance | White to off-white Solid | | Optical Rotation | Consistent with structure | | BRN | 4906961 | | Major Application | peptide synthesis | | InChI | 1S/C15H15NO2/c16-14(15(17)18)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13-14H,16H2,(H,17,18)/t14-/m1/s1 | | InChIKey | PECGVEGMRUZOML-CQSZACIVSA-N | | SMILES | N[C@H](C(c1ccccc1)c2ccccc2)C(O)=O | | CAS DataBase Reference | 149597-91-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids |
| | 3,3-Diphenyl-D-alanine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | 3,3-Diphenyl-D-alanine is used in the coupling of diphenylalanine with D-leucine Methyl ester. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | 3,3-Diphenyl-D-alanine Preparation Products And Raw materials |
|