- 2-BROMO-5-NITRO-6-PICOLINE
-
- $5.00 / 1KG
-
2025-09-25
- CAS:22282-96-8
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2-BROMO-5-NITRO-6-PICOLINE Basic information |
| | 2-BROMO-5-NITRO-6-PICOLINE Chemical Properties |
| Melting point | 69-70°C | | Boiling point | 274.0±35.0 °C(Predicted) | | density | 1.709±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform | | form | Solid | | pka | -2.52±0.10(Predicted) | | color | Yellow | | InChI | 1S/C6H5BrN2O2/c1-4-5(9(10)11)2-3-6(7)8-4/h2-3H,1H3 | | InChIKey | PCNVKBBKROTUNS-UHFFFAOYSA-N | | SMILES | Cc1nc(Br)ccc1[N+]([O-])=O | | CAS DataBase Reference | 22282-96-8(CAS DataBase Reference) |
| Hazard Codes | T,Xi,Xn | | Risk Statements | 22-37/38-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 2-BROMO-5-NITRO-6-PICOLINE Usage And Synthesis |
| Chemical Properties | Yellow Solid |
| | 2-BROMO-5-NITRO-6-PICOLINE Preparation Products And Raw materials |
|