| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5-Amino-1-naphthol Basic information |
| | 5-Amino-1-naphthol Chemical Properties |
| Melting point | 190 °C (dec.) (lit.) | | Boiling point | 284.68°C (rough estimate) | | density | 1.1202 (rough estimate) | | refractive index | 1.6070 (estimate) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 3.97(at 25℃) | | form | Solid | | color | Light Purple to Purple | | InChI | InChI=1S/C10H9NO/c11-9-5-1-4-8-7(9)3-2-6-10(8)12/h1-6,12H,11H2 | | InChIKey | ZBIBQNVRTVLOHQ-UHFFFAOYSA-N | | SMILES | C1(O)=C2C(C(N)=CC=C2)=CC=C1 | | CAS DataBase Reference | 83-55-6(CAS DataBase Reference) | | NIST Chemistry Reference | 5-Amino-1-naphthol(83-55-6) | | EPA Substance Registry System | 1-Naphthalenol, 5-amino- (83-55-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29222990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-Amino-1-naphthol Usage And Synthesis |
| Chemical Properties | pale purple to brown-purple crystalline powder | | Uses | 5-Amino-1-naphthol is used as a coupling component for azo dyes (coupling takes place ortho to the amino or hydroxyl group, or para to the hydroxyl group depending on the pH), and as an intermediate for sulfur dyes. | | Preparation | 1-Aminonaphthalene-5-sulfonic acid paste (Section 6.2) is added to molten sodium hydroxide at 200°C, and the reaction is completed by heating slowly to 250°C and maintaining this temperature for 3 h. After dilution and careful neutralization with hydrochloric acid, 5-amino-1-naphthol precipitates in 85 % yield (mp 192°C). |
| | 5-Amino-1-naphthol Preparation Products And Raw materials |
| Raw materials | 5-Nitro-1-naphthol-->5-Amino-3,4-dihydronaphthalen-1(2H)-one-->5-Nitro-1-tetralone-->1-Naphthalenesulfonic acid, 8-amino-4-hydroxy--->1,5-Naphthalenediamine-->Sodium 4-amino-1-naphthalenesulfonate-->5-Amino-1-naphthalenesulfonic acid-->1-Naphthol-->N,N-Dimethylaniline | | Preparation Products | 1,5-Dihydroxy naphthalene-->2,5-Cyclohexadien-1-one, 4-[(4-amino-8-hydroxy-1-naphthalenyl)imino]-, reaction products with sodium sulfide (Na2(Sx))-->Leuco Sulphur Brown 16-->1-Naphthalenol, 5-amino-, sulfurized-->2,7-Naphthalenedisulfonic acid, 4-[(1-amino-5-hydroxynaphthalenyl)azo]-5-hydroxy-, disodium salt-->tert-butyl 5-hydroxynaphthalen-1-ylcarbamate |
|