|
|
| | 2-Chloro-3-nitro-6-methylpyridine Basic information |
| | 2-Chloro-3-nitro-6-methylpyridine Chemical Properties |
| Melting point | 70-74 °C | | Boiling point | 200°C (rough estimate) | | density | 1.5610 (rough estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | soluble in Methanol | | form | Powder | | pka | -1+-.0.10(Predicted) | | color | Brown | | InChI | InChI=1S/C6H5ClN2O2/c1-4-2-3-5(9(10)11)6(7)8-4/h2-3H,1H3 | | InChIKey | UIEVSGOVFXWCIK-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC(C)=CC=C1[N+]([O-])=O | | CAS DataBase Reference | 56057-19-3(CAS DataBase Reference) |
| Provider | Language |
|
ACROS
| English |
| | 2-Chloro-3-nitro-6-methylpyridine Usage And Synthesis |
| Chemical Properties | brown powder | | Uses | Iridium complexes with 2-phenylpyridine and 2-(4-dibenzofuran)pyridine as ligands are widely used organic phosphorescent materials. | | Synthesis | 2-Hydroxy-3-nitro-6-methylpyridine (compound 25, 10 g, 0.065 mol) was added to 50 mL of phosphoryl chloride and heated to reflux for 4 hours. Upon completion of the reaction, most of the phosphorus trichloride was removed by distillation under reduced pressure. The residue was slowly poured into 200 g of ice water and stirred for 2 hours. A large amount of precipitate appeared in the reaction mixture and the precipitate was collected by filtration under reduced pressure and dried under vacuum to give 10 g of white solid product (compound 26) in 89% yield. The melting point of the product was 68.5-70.5 °C (water) [J.O.C., 1955, 20, 1729-1731]. | | References | [1] Patent: EP2366691, 2011, A1. Location in patent: Page/Page column 11-12
[2] Journal of Medicinal Chemistry, 2000, vol. 43, # 22, p. 4288 - 4312
[3] Journal of the American Chemical Society, 1952, vol. 74, p. 3828,3830 |
| | 2-Chloro-3-nitro-6-methylpyridine Preparation Products And Raw materials |
|