| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- Boc-D-Phenylglycinol
-
- $32.00
-
2026-09-11
- CAS:102089-74-7
- Min. Order: 100g
- Purity: 0.98
- Supply Ability: 25kg
- Boc-D- Phg-Ol
-
-
2026-09-11
- CAS:102089-74-7
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | (R)-N-(tert-Butoxycarbonyl)-2-phenylglycinol Basic information |
| | (R)-N-(tert-Butoxycarbonyl)-2-phenylglycinol Chemical Properties |
| Melting point | 137-139 °C(lit.) | | alpha | -38°(19℃, c=1, CHCl3) | | Boiling point | 382.4±35.0 °C(Predicted) | | density | 1.101±0.06 g/cm3(Predicted) | | vapor pressure | 0-70Pa at 20-50℃ | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 11.55±0.46(Predicted) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]19/D 38°, c = 1 in chloroform | | BRN | 4688248 | | Major Application | peptide synthesis | | InChI | InChI=1S/C13H19NO3/c1-13(2,3)17-12(16)14-11(9-15)10-7-5-4-6-8-10/h4-8,11,15H,9H2,1-3H3,(H,14,16)/t11-/m0/s1 | | InChIKey | IBDIOGYTZBKRGI-NSHDSACASA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@H](C1=CC=CC=C1)CO | | LogP | 1.59 | | CAS DataBase Reference | 102089-74-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-25-24 | | WGK Germany | 3 | | HS Code | 29051990 | | Storage Class | 11 - Combustible Solids |
| | (R)-N-(tert-Butoxycarbonyl)-2-phenylglycinol Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | Chiral building block | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | (R)-N-(tert-Butoxycarbonyl)-2-phenylglycinol Preparation Products And Raw materials |
|