|
|
| | 5-(4-Fluorophenyl)thiophene-2-carboxylic acid Basic information |
| | 5-(4-Fluorophenyl)thiophene-2-carboxylic acid Chemical Properties |
| Melting point | 250-254 °C (lit.) | | Boiling point | 389.6±32.0 °C(Predicted) | | density | 1.380±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | pka | 3.46±0.10(Predicted) | | form | powder to crystal | | color | White to Orange to Green | | InChI | 1S/C11H7FO2S/c12-8-3-1-7(2-4-8)9-5-6-10(15-9)11(13)14/h1-6H,(H,13,14) | | InChIKey | YOFXYDVYMHOXSY-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccc(s1)-c2ccc(F)cc2 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36-24/25-22 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids |
| | 5-(4-Fluorophenyl)thiophene-2-carboxylic acid Usage And Synthesis |
| | 5-(4-Fluorophenyl)thiophene-2-carboxylic acid Preparation Products And Raw materials |
|