- Lobetyolin
-
- $48.00
-
2026-07-15
- CAS:129277-38-9
- Purity: 97.32%
- Supply Ability: 10g
- Lobetyolin
-
-
2023-02-24
- CAS:136085-37-5
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
- Lobetyolin
-
-
2023-02-24
- CAS:136085-37-5
- Min. Order: 5mg
- Purity: Analytical Standard
- Supply Ability: 10 g
|
| | Lobetyolin Basic information |
| Product Name: | Lobetyolin | | Synonyms: | Lobetyolin;Lebetyolin;(4E,12E)-6-(β-D-Glucopyranosyloxy)-4,12-tetradecadiene-8,10-diyne-1,7-diol;(4E,12E)-6-β-D-Glucopyranosyloxytetradeca-4,12-diene-8,10-diyne-1,7-diol;Iobetyolin;hydroxy-1-penten-1-yl]-7-nonene-3,5-diyn-1-yl;β-D-Glucopyranoside, (7E)-2-hydroxy-1-[(1E)-5-;Lobetyolin, 98%, from Codonopsis pilosula (Franch.) Nannf. | | CAS: | 136085-37-5 | | MF: | C20H28O8 | | MW: | 396.433 | | EINECS: | | | Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract | | Mol File: | 136085-37-5.mol |  |
| | Lobetyolin Chemical Properties |
| Melting point | >74°C (dec.) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Yellow to Dark Orange | | Stability: | Hygroscopic | | InChIKey | MMMUDYVKKPDZHS-DJOCLIFKNA-N | | SMILES | [C@@H]1(OC(C(O)C#CC#C/C=C/C)/C=C/CCCO)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |&1:0,19,22,24,26,r| |
| Safety Statements | 24/25 | | HS Code | 29389090 |
| | Lobetyolin Usage And Synthesis |
| Chemical Properties | Derived from Codonopsis pilosula (Codonopsis pilosula), family Platycodonaceae | | Uses | Lobetyolin is a natural phenolic glycoside found in herbal remedies used in Chinese and Korean medicine. Potential treatment for diabetic complications. |
| | Lobetyolin Preparation Products And Raw materials |
|