| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-Hydroxypyridine-2-carboxylic acid Basic information |
| | 4-Hydroxypyridine-2-carboxylic acid Chemical Properties |
| Melting point | ca 280℃ | | Boiling point | 582.3±35.0 °C(Predicted) | | density | 1.485±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 1.20±0.50(Predicted) | | form | powder to crystal | | color | White to Almost white | | Water Solubility | slightly soluble in water. | | InChI | InChI=1S/C6H5NO3/c8-4-1-2-7-5(3-4)6(9)10/h1-3H,(H,7,8)(H,9,10) | | InChIKey | MXXLHBCSVDDTIX-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)=NC=CC(O)=C1 | | CAS DataBase Reference | 22468-26-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Hydroxypyridine-2-carboxylic acid Usage And Synthesis |
| Chemical Properties | White powder | | Uses | It is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuffs. |
| | 4-Hydroxypyridine-2-carboxylic acid Preparation Products And Raw materials |
|