| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- Boc-D-Val-Ol
-
-
2026-09-11
- CAS:106391-87-1
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- N-Boc-D-Valino
-
- $1.00
-
2019-12-25
- CAS:106391-87-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kg
|
| | N-Boc-D-Valino Basic information |
| Product Name: | N-Boc-D-Valino | | Synonyms: | N-ALPHA-TERT-BUTYLOXYCARBONYL-L-ALANINOL-2R-BOC-AMINO-1-PROPANOL;N-ALPHA-T-BUTYLOXYCARBONYL-L-ALANINOL-2R-BOC-AMINO-1-PROPANOL;NALPHA-tert-Butoxycarbonyl-D-valinol;N-Boc-D-Valino;N-alpha-t-Butyloxycarbonyl-D-alaninol, (R)-2-(t-Butyloxycarbonyl-amino)-1-propanol;N-alpha-t-Butyloxycarbonyl-D-valinol, (R)-2-(t-Butyloxycarbonyl-amino)-3-methyl-1-butanol;N-[(2R)-1-hydroxy-3-methylbutan-2-yl]carbamic acid tert-butyl ester;N-BOC-D-Valinol,98% | | CAS: | 106391-87-1 | | MF: | C10H21NO3 | | MW: | 203.28 | | EINECS: | | | Product Categories: | Amino Alcohols;Boc-Amino acid series;Amino Acids | | Mol File: | 106391-87-1.mol |  |
| | N-Boc-D-Valino Chemical Properties |
| Melting point | 68-72 °C | | alpha | 23 º (c=1 in chloroform) | | Boiling point | 218 °C | | density | 0.995 g/mL at 25 °C | | refractive index | n20/D 1.451(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 12.02±0.46(Predicted) | | form | Liquid | | Specific Gravity | 0.995 | | color | Pale yellow | | Optical Rotation | [α]23/D +23°, c = 1 in chloroform | | Major Application | peptide synthesis | | InChI | 1S/C10H21NO3/c1-7(2)8(6-12)11-9(13)14-10(3,4)5/h7-8,12H,6H2,1-5H3,(H,11,13)/t8-/m0/s1 | | InChIKey | OOQRRYDVICNJGC-QMMMGPOBSA-N | | SMILES | CC(C)[C@H](CO)NC(=O)OC(C)(C)C | | CAS DataBase Reference | 106391-87-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29224985 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | N-Boc-D-Valino Usage And Synthesis |
| Chemical Properties | Clear colorless liquid | | Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | N-Boc-D-Valino Preparation Products And Raw materials |
|