| Company Name: |
SIMAGCHEM CORP |
| Tel: |
+86-5922680277 +86-13806087780 |
| Email: |
sale@simagchem.com |
|
| | N,N-Dimethylformamide dicyclohexyl acetal Basic information |
| Product Name: | N,N-Dimethylformamide dicyclohexyl acetal | | Synonyms: | 1,1-DICYCLOHEXYLOXYTRIMETHYLAMINE;DMF-DCHA;1,1-bis(cyclohexyloxy)trimethylamine;α,α-Bis(cyclohexyloxy)-N,N-dimethylmethanamine;N,N-Dimethylformamide dicyclohexyl acetal,99%;Methanamine, 1,1-bis(cyclohexyloxy)-N,N-dimethyl-;SKL1153;N,N-Dimethylformamide dicyclohexyl acetal | | CAS: | 2016-05-9 | | MF: | C15H29NO2 | | MW: | 255.4 | | EINECS: | 217-947-2 | | Product Categories: | | | Mol File: | 2016-05-9.mol |  |
| | N,N-Dimethylformamide dicyclohexyl acetal Chemical Properties |
| Boiling point | 115-116 °C0.75 mm Hg(lit.) | | density | 0.958 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.4678(lit.) | | Fp | 195 °F | | pka | 4.84±0.50(Predicted) | | InChI | InChI=1S/C15H29NO2/c1-16(2)15(17-13-9-5-3-6-10-13)18-14-11-7-4-8-12-14/h13-15H,3-12H2,1-2H3 | | InChIKey | GCCBITPXNLHRFH-UHFFFAOYSA-N | | SMILES | C(OC1CCCCC1)(OC1CCCCC1)N(C)C |
| | N,N-Dimethylformamide dicyclohexyl acetal Usage And Synthesis |
| Definition | ChEBI: N,N-Dimethylformamide dicyclohexyl acetal is an organic amino compound and an organic hydroxy compound. |
| | N,N-Dimethylformamide dicyclohexyl acetal Preparation Products And Raw materials |
|