| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
1,1-Dibutoxytrimethylamine manufacturers
|
| | 1,1-Dibutoxytrimethylamine Basic information |
| Product Name: | 1,1-Dibutoxytrimethylamine | | Synonyms: | N,N-Dimethylformamide di-n-butyl acetal, 98+%;1,1-Dibutoxy-N,N-dimethylmethylamine, 1,1-Dibutoxytrimethylamine;dibutoxymethyl(dimethyl)amine;1,1-Dibutoxy-N,N-dimethylmethanamine;α,α-Dibutoxy-N,N-dimethylmethanamine;N,N-Dimethylformamide Dibutyl Acetal N,N-Dimethylformamide Dibutyl Acetal [for Esterification];1,1-DIBUTOXY-N,N-DIMETHYLMETHYLAMINE | | CAS: | 18503-90-7 | | MF: | C11H25NO2 | | MW: | 203.32 | | EINECS: | 242-387-0 | | Product Categories: | GC Derivatizing Reagents;N,N-Dimethylformamide Dialkylacetals (GC Derivatizing Reagents);Acetals/Ketals/Ortho Esters;Building Blocks;Chemical Synthesis;Organic Building Blocks;Oxygen Compounds;Analytical Chemistry;Esterification & Alkylation (GC Derivatizing Reagents) | | Mol File: | 18503-90-7.mol |  |
| | 1,1-Dibutoxytrimethylamine Chemical Properties |
| Boiling point | 93 °C12 mm Hg(lit.) | | density | 0.853 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.417 | | Fp | 53°C | | pka | 5.22±0.50(Predicted) | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 0.852 | | BRN | 1098693 | | InChI | InChI=1S/C11H25NO2/c1-5-7-9-13-11(12(3)4)14-10-8-6-2/h11H,5-10H2,1-4H3 | | InChIKey | GSFFXKGTGPMVLM-UHFFFAOYSA-N | | SMILES | C(OCCCC)(OCCCC)N(C)C | | CAS DataBase Reference | 18503-90-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | HS Code | 2924.19.8000 | | HazardClass | 3.2 | | PackingGroup | III | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| | 1,1-Dibutoxytrimethylamine Usage And Synthesis |
| Uses | N,N-Dimethylformamide dibutyl acetal is the suitable reagent used for the simultaneous quantification of cocaine and its primary metabolite, benzoyl ecgonine, from a urine matrix by gas-chromatography. It may be used as reagent for the esterification of fatty acids. | | General Description | N,N-Dimethylformamide dibutyl acetal (1,1-Dibutoxytrimethylamine, 1,1-Dibutoxy-N,N-dimethylmethylamine) is a dimethylformamide dialkyl acetal. Its synthesis has been reported by Meerwin and coworkers by reaction of N,N-Dimethylformamide diethyl acetal with butanol. | | Synthesis | 1,1-Dibutoxytrimethylamine is used in the preparation of the intermediate 1,2,4-triazole-3-carboxamide for ribavirin. |
| | 1,1-Dibutoxytrimethylamine Preparation Products And Raw materials |
|