| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Aminomethylphenylboronic acid hydrochloride Basic information |
| | 3-Aminomethylphenylboronic acid hydrochloride Chemical Properties |
| Melting point | 248-250°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | color | Cream | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C7H10BNO2.ClH/c9-5-6-2-1-3-7(4-6)8(10)11;/h1-4,10-11H,5,9H2;1H | | InChIKey | NPTBTFRGCBFYPZ-UHFFFAOYSA-N | | SMILES | C1(B(O)O)=CC=CC(CN)=C1.[H]Cl | | CAS DataBase Reference | 352525-94-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| | 3-Aminomethylphenylboronic acid hydrochloride Usage And Synthesis |
| Uses | 3-(Aminomethyl)benzeneboronic acid hydrochloride is used as intermediates. Hydroxybenzene boronic acids are involved in suzuki miyaura reactions. It is a arylboronic acid. 3-Fluoro-4-hydroxybenzeneboronic acid, can be an effective catalyst for amidation and esterification of carboxylic acids. |
| | 3-Aminomethylphenylboronic acid hydrochloride Preparation Products And Raw materials |
|