|
|
| | 6-chloro-1H-indazol-3-amine Basic information |
| Product Name: | 6-chloro-1H-indazol-3-amine | | Synonyms: | 6-Chloro-1H-Indazol-3-Amine
(6-Chloro-1H-Indazol-3-Yl)Amine;Zinc00154498;6-chloro-1H-indazol-3-amine;Einecs 240-925-9;3-Amino-6-chloro-1H-indazole;1H-Indazol-3-amine, 6-chloro-;6-chloro-1H-indoleazole-3-amine | | CAS: | 16889-21-7 | | MF: | C7H6ClN3 | | MW: | 167.6 | | EINECS: | 240-925-9 | | Product Categories: | | | Mol File: | 16889-21-7.mol |  |
| | 6-chloro-1H-indazol-3-amine Chemical Properties |
| Boiling point | 408.7±25.0 °C(Predicted) | | density | 1.533±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 13.72±0.40(Predicted) | | Appearance | Off-white to pale purple Solid | | InChI | InChI=1S/C7H6ClN3/c8-4-1-2-5-6(3-4)10-11-7(5)9/h1-3H,(H3,9,10,11) | | InChIKey | BPTYMRSBTUERSW-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC(Cl)=C2)C(N)=N1 |
| | 6-chloro-1H-indazol-3-amine Usage And Synthesis |
| Uses | Starting from 6-chloro-1H-indazol-3-amine, the EDC/HOAt promoted coupling with the (S)-carboxylic acid derivative furnished (S)-1-(3-Amino-6-chloro-1H-indazol-1-yl)-2-methyl-3-phenoxypro-pan-1-one. This synthesis was performed to explore the structure-activity relationships (SAR) by substituting the indazole scaffold at the 6-position with a chlorine atom, facilitating the identification of novel CFTR potentiators.[1] | | References |
[1] Liu, F., Kaplan, A. L., Levring, J., Einsiedel, J., Tiedt, S., Distler, K., Omattage, N. S., Kondratov, I. S., Moroz, Y. S., Pietz, H. L., Irwin, J. J., Gmeiner, P., Shoichet, B. K., & Chen, J. (2024). Structure-based discovery of CFTR potentiators and inhibitors. Cell, 42 1. https://doi.org/10.1016/j.cell.2024.04.046
|
| | 6-chloro-1H-indazol-3-amine Preparation Products And Raw materials |
|