- FMOC-GLU(EDANS)-OH
-
- $1.00 / 1KG
-
2019-07-06
- CAS:193475-66-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | FMOC-GLU(EDANS)-OH Basic information |
| Product Name: | FMOC-GLU(EDANS)-OH | | Synonyms: | (S)-2-(((9H-fluoren-9-yl)methyl9H-fluoren-9-yl)methoxy)carbonylamino)-5-oxo-5-(2-(5-sulfonaphthalen-2-ylamino)ethylamino)pentanoic acid;FMoc-L-glutaMic acid-gaMMa-[2-(1-sulfonyl-5-naphthyl)-aMinoethylaMide;N2-[(9H-Fluoren-9-ylMethoxy)carbonyl]-N-[2-[(5-sulfo-1-naphthalenyl)aMino]ethyl]-L-glutaMine;Fmoc-L-glutamic acid γ-[β-(5-naphthyl sulfonic acid)-ethylenediamine] ester;Fmoc-Glu(Edans);Fmoc-L-glutamic acid γ-[β-(5-naphthyl sulfonic acid)-ethylenediamine] ester≥ 97% (HPLC);(9H-Fluoren-9-yl)MethOxy]Carbonyl Glu(Edans)-OH;(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-[2-[(5-sulfonaphthalen-1-yl)amino]ethylamino]pentanoic acid | | CAS: | 193475-66-0 | | MF: | C32H31N3O8S | | MW: | 617.67 | | EINECS: | | | Product Categories: | peptides | | Mol File: | 193475-66-0.mol |  |
| | FMOC-GLU(EDANS)-OH Chemical Properties |
| Melting point | >220°C (dec.) | | density | 1.418±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | DMSO, Methanol, Water | | form | Solid | | pka | -0.26±0.40(Predicted) | | color | Off-White | | Optical Rotation | -3°(C=0.01g/ml DMF) | | Major Application | peptide synthesis | | InChIKey | HPYLYODKLGEPPX-NDEPHWFRSA-N | | SMILES | [S](=O)(=O)(O)c1c2c(c(ccc2)NCCNC(=O)CC[C@H](NC(=O)OCC3c4c(cccc4)c5c3cccc5)C(=O)O)ccc1 |
| WGK Germany | WGK 2 | | HS Code | 29225090 | | Storage Class | 11 - Combustible Solids |
| | FMOC-GLU(EDANS)-OH Usage And Synthesis |
| Chemical Properties | Off-white solid | | Uses | A fluroescent probe. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-GLU(EDANS)-OH Preparation Products And Raw materials |
|