3'-O-methylguanosine manufacturers
|
| | 3'-O-methylguanosine Basic information |
| Product Name: | 3'-O-methylguanosine | | Synonyms: | 2-amino-9-[(2R,3R,4S,5R)-3-hydroxy-5-(hydroxymethyl)-4-methoxyoxolan-2-yl]-3H-purin-6-one;3'-OMe-G;Guanosine, 3'-O-methyl-;"2-AMINO-9-[3-HYDROXY-5-(HYDROXYMETHYL)-4-METHOXYOXOLAN-2-YL]-3H-PURIN-6-ONE;3'-O-Me-Gr;3'-O-methylguanosine top3;2-amino-9-[(2R,3R,4S,5R)-3-hydroxy-5-(hydroxymethyl)-4-methoxyoxolan-2-yl]-3H-purin-6-one USP/EP/BP;2-amino-9-((2R,3R,4S,5R)-3-hydroxy-5-(hydroxy methyl)-4-methoxy tetra hydrofuran-2-yl)-1H-purin-6(9H)-one | | CAS: | 10300-27-3 | | MF: | C11H15N5O5 | | MW: | 297.27 | | EINECS: | | | Product Categories: | 10300-27-3;Pharmaceutical;Modified（deoxy）nucleoside;Nucleosides-3'-OMe Nucleosides | | Mol File: | 10300-27-3.mol |  |
| | 3'-O-methylguanosine Chemical Properties |
| Melting point | 263-300 °C (decomp) | | density | 1.98±0.1 g/cm3(Predicted) | | storage temp. | 4°C, stored under nitrogen | | solubility | DMSO : 25 mg/mL (84.10 mM; ultrasonic and warming and heat to 60°C) | | form | Solid | | pka | 9+-.0.20(Predicted) | | color | White to off-white | | InChI | InChI=1S/C11H15N5O5/c1-20-7-4(2-17)21-10(6(7)18)16-3-13-5-8(16)14-11(12)15-9(5)19/h3-4,6-7,10,17-18H,2H2,1H3,(H3,12,14,15,19)/t4-,6-,7-,10-/m1/s1 | | InChIKey | UYARPHAXAJAZLU-KQYNXXCUSA-N | | SMILES | OC[C@H]1O[C@@H](N2C3=C(C(NC(=N3)N)=O)N=C2)[C@H](O)[C@@H]1OC |
| | 3'-O-methylguanosine Usage And Synthesis |
| Description | 3'-O-Methylguanosine is an antiviral nucleoside analog.1 It inhibits viral plaque formation and viral RNA synthesis in vaccinia virus-infected Vero cells when used at a concentration of 10 µM.WARNING This product is not for human or veterinary use. | | Definition | ChEBI: Guanosine with the hydrogen on the hydroxyl at position C-3' substituted with a methyl group. |
| | 3'-O-methylguanosine Preparation Products And Raw materials |
|