- Curzerene
-
-
2025-04-04
- CAS:17910-09-7
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1ton
- isofuranogermacrene
-
- $9.80
-
2020-01-10
- CAS:17910-09-7
- Min. Order: 1KG
- Purity: ≥98%
- Supply Ability: 20 tons
|
| | Curzerene Basic information |
| Product Name: | Curzerene | | Synonyms: | Curzerene;Isofuranogermacrene;Isogermafuren;Neocurzerene;Benzofuran, 6-ethenyl-4,5,6,7-tetrahydro-3,6-dimethyl-5-(1-methylethenyl)-, (5R,6R)-rel-;Isogermafurene | | CAS: | 17910-09-7 | | MF: | C15H20O | | MW: | 216.32 | | EINECS: | | | Product Categories: | | | Mol File: | 17910-09-7.mol |  |
| | Curzerene Chemical Properties |
| Boiling point | 282.8±40.0℃ (760 Torr) | | density | 0.982±0.06 g/cm3 (20 ºC 760 Torr) | | Fp | 117.5±14.2℃ | | solubility | Soluble in chloroform | | form | liquid | | color | Yellow oily | | InChI | InChI=1/C15H20O/c1-6-15(5)8-14-12(11(4)9-16-14)7-13(15)10(2)3/h6,9,13H,1-2,7-8H2,3-5H3/t13-,15+/s3 | | InChIKey | HICAMHOOTMOHPA-MJZDCSSWNA-N | | SMILES | O1C2C[C@@](C=C)(C)[C@@H](C(C)=C)CC=2C(C)=C1 |&1:3,7,r| | | LogP | 3.982 (est) |
| | Curzerene Usage And Synthesis |
| Chemical Properties | Colorless crystals, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from Curcuma zedoaria. | | Uses | Curzerene is a sesquiterpene is isolated from the rhizome of Curculigo orchioides Gaertn with anti-cancer activity. Curzerene inhibits glutathione S-transferase A1 (GSTA1) mRNA and protein expression. Curzerene induces cell apoptosis[1]. | | References | [1] Wang Y, et al. Cytotoxic and Antitumor Effects of Curzerene from Curcuma longa. Planta Med. 2017 Jan;83(1-02):23-29. DOI:10.1055/s-0042-107083 |
| | Curzerene Preparation Products And Raw materials |
|