|
|
| | (-)-Di-tert-butyl D-tartrate Basic information |
| Product Name: | (-)-Di-tert-butyl D-tartrate | | Synonyms: | DI-TERT-BUTYL D-TARTRATE;DI-TERT-BUTYL D-TARTRATE 99%;di-tert-butyl tartrate;(S,S)-Di-tert-butyl-tartrat;(2S,3S)-Di-tert-butyl 2,3-dihydroxysuccinate;Butanedioic acid, 2,3-dihydroxy-, 1,4-bis(1,1-dimethylethyl) ester, (2S,3S)-;Di-tert-butyl (2S,3S)-2,3-dihydroxysuccinate;(-)-Di-tert-butyl D-tartrate | | CAS: | 117384-46-0 | | MF: | C12H22O6 | | MW: | 262.3 | | EINECS: | | | Product Categories: | EpoxidationChiral Building Blocks;Asymmetric Synthesis;Chiral Catalysts, Ligands, and Reagents;Esters;Organic Building Blocks | | Mol File: | 117384-46-0.mol |  |
| | (-)-Di-tert-butyl D-tartrate Chemical Properties |
| Melting point | 90-92 °C(lit.) | | Boiling point | 321.8±9.0 °C(Predicted) | | density | 1.143±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 11.44±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C12H22O6/c1-11(2,3)17-9(15)7(13)8(14)10(16)18-12(4,5)6/h7-8,13-14H,1-6H3/t7-,8-/m0/s1 | | InChIKey | ITWOKJQQGHCDBL-YUMQZZPRSA-N | | SMILES | C(OC(C)(C)C)(=O)[C@@H](O)[C@H](O)C(OC(C)(C)C)=O |
| | (-)-Di-tert-butyl D-tartrate Usage And Synthesis |
| | (-)-Di-tert-butyl D-tartrate Preparation Products And Raw materials |
|