| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
|
| | Mebhydrolin napadisylate Basic information |
| Product Name: | Mebhydrolin napadisylate | | Synonyms: | MEBHYDROLIN NAPADISYLATE;9-Benzyl-N-Methyl-1,2,3,4-Tetrahydro-A-Carboline;l-1h-pyrido(4,3-b)indol(1:2);omeril;3-methyl-9-benzyl-1,2,3,4-tetrahydrocarbolymnaphthalyn-1,5-disulphonate;9-BENZYL-N-METHYL-1,2,3,4-TETRAHYDRO-ALPHA-CARBOLINE 1,5-NAPHTHALENEDISULFONATE SALT;Mebhydrolin napadisylate MEBHYDROLINE 1,5-NAPHTHALENEDISULFONATE SALT;5-naphthalenedisulfonate salt | | CAS: | 6153-33-9 | | MF: | C48H48N4O6S2 | | MW: | 841.05 | | EINECS: | 228-170-3 | | Product Categories: | Piperazine derivates | | Mol File: | 6153-33-9.mol |  |
| | Mebhydrolin napadisylate Chemical Properties |
| Melting point | 280°C (rough estimate) | | Boiling point | 409.28°C (rough estimate) | | density | 0.9799 (rough estimate) | | refractive index | 1.8676 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) | | form | Solid | | color | White to Off-White | | InChIKey | CJUOSBUQOWKEKJ-UHFFFAOYSA-N | | SMILES | N1(CC2=CC=CC=C2)C2C=CC=CC=2C2CN(C)CCC1=2.N1(CC2C=CC=CC=2)C2C=CC=CC=2C2CN(C)CCC1=2.C12C=CC=C(S(=O)(=O)O)C1=CC=CC=2S(=O)(=O)O |
| WGK Germany | 3 | | RTECS | QJ6845000 |
| | Mebhydrolin napadisylate Usage And Synthesis |
| Chemical Properties | White or almost white crystalline | | Uses | Mebhydrolin (INN) is an antihistamine. Mebhydrolin napadisylate is used for symptomatic relief of allergic symptoms caused by histamine release, including nasal allergies and allergic dermatosis. | | Uses | Mebhydrolin (INN) is an antihistamine. Mebhydrolin is used for symptomatic relief of allergic symptoms caused by histamine release, including nasal allergies and allergic dermatosis. | | Definition | ChEBI: Mebhydrolin napadisilate is a polymer. |
| | Mebhydrolin napadisylate Preparation Products And Raw materials |
|