| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-(3-Methoxy-phenyl)-3-oxo-propionic acid ethyl ester Basic information |
| | 3-(3-Methoxy-phenyl)-3-oxo-propionic acid ethyl ester Chemical Properties |
| Boiling point | >268 °C(lit.) | | density | 1.146 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.5360(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | form | clear liquid | | pka | 10.28±0.46(Predicted) | | color | Colorless to Light yellow to Light orange | | InChI | 1S/C12H14O4/c1-3-16-12(14)8-11(13)9-5-4-6-10(7-9)15-2/h4-7H,3,8H2,1-2H3 | | InChIKey | FDPPVAYPZOORBP-UHFFFAOYSA-N | | SMILES | CCOC(=O)CC(=O)c1cccc(OC)c1 | | CAS DataBase Reference | 27834-99-7(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2918.99.4700 | | Storage Class | 10 - Combustible liquids |
| | 3-(3-Methoxy-phenyl)-3-oxo-propionic acid ethyl ester Usage And Synthesis |
| Uses | Reactant involved in:• ;Stereoselective ketonization-olefination of indoles1• ;Lewis base catalyzed hydrosilylation2 and sequential reactions3,4• ;Asymmetric hydrogenation5• ;Organocatalytic reduction by trichlorosilane6 | | Uses | Reactant involved in:
- Stereoselective ketonization-olefination of indoles
- Lewis base catalyzed hydrosilylation and sequential reactions
- Asymmetric hydrogenation
- Organocatalytic reduction by trichlorosilane
|
| | 3-(3-Methoxy-phenyl)-3-oxo-propionic acid ethyl ester Preparation Products And Raw materials |
|