|
|
| | 5-Bromoacetyl salicylamide Basic information |
| | 5-Bromoacetyl salicylamide Chemical Properties |
| Melting point | 200-210°C | | Boiling point | 420.2±40.0 °C(Predicted) | | density | 1.705±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 6.13±0.20(Predicted) | | color | Pale Beige to Brown | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C9H8BrNO3/c10-4-8(13)5-1-2-7(12)6(3-5)9(11)14/h1-3,12H,4H2,(H2,11,14) | | InChIKey | VXWSXLSUWGZOHD-UHFFFAOYSA-N | | SMILES | C(N)(=O)C1=CC(C(CBr)=O)=CC=C1O | | CAS DataBase Reference | 73866-23-6(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | RTECS | CV2365900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| Provider | Language |
|
ALFA
| English |
| | 5-Bromoacetyl salicylamide Usage And Synthesis |
| Chemical Properties | Class white light yellow powder | | Uses | 5-Bromoacetyl-2-hydroxybenzamide is a reagent used in the synthesis of bisthiazole derivatives and novel 7-methylguanine derivatives targeting influenza polymerase binding domains. |
| | 5-Bromoacetyl salicylamide Preparation Products And Raw materials |
|